CAS 77151-48-5

4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-amine

Description:

4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-amine, with the CAS number 77151-48-5, is an organic compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features two para-methoxyphenyl groups attached to the oxazole ring, contributing to its aromatic character and potentially influencing its solubility and reactivity. The presence of the amine functional group indicates that it can participate in hydrogen bonding, which may enhance its interactions in biological systems or with other chemical entities. The compound may exhibit interesting properties such as fluorescence or photostability, making it of interest in various applications, including materials science and pharmaceuticals. Its molecular structure suggests potential uses in drug development or as a building block in organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for comprehensive characterization.

Formula: C₁₇H₁₆N₂O₃

InChI: InChI=1/C17H16N2O3/c1-20-13-7-3-11(4-8-13)15-16(22-17(18)19-15)12-5-9-14(21-2)10-6-12/h3-10H,1-2H3,(H2,18,19)

SMILES: COc1ccc(cc1)c1c(c2ccc(cc2)OC)oc(=N)[nH]1

Synonyms:

• 2-Oxazolamine, 4,5-Bis(4-Methoxyphenyl)-
• 4,5-Bis-(4-methoxy-phenyl)-oxazol-2-ylamine
• 4,5-Bis(4-methoxyphenyl)-1,3-oxazol-2-amine

Bis(4-methoxyphenyl)-1,3-oxazol-2-amine

CAS: 77151-48-5

Versatile small molecule scaffold

Formula: C₁₇H₁₆N₂O₃

Purity: Min. 95%

Molecular weight: 296.32 g/mol

Ref: 3D-CDA15148