CAS 771528-90-6
:3-amino-3-(3-pyridyl)propanamide
Description:
3-Amino-3-(3-pyridyl)propanamide is an organic compound characterized by the presence of an amine group and a pyridine ring, which contributes to its unique chemical properties. The structure consists of a propanamide backbone with an amino group attached to the third carbon and a pyridine ring at the same position, influencing its reactivity and solubility. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the amide functional group. It may exhibit basic properties due to the amino group and can participate in hydrogen bonding, which enhances its interactions in biological systems. The pyridine moiety can also engage in π-π stacking interactions, making it relevant in various chemical and pharmaceutical applications. Additionally, the compound may serve as a building block in the synthesis of more complex molecules or as a ligand in coordination chemistry. Its specific applications and behavior can vary based on the context of use, including potential roles in medicinal chemistry or material science.
Formula:C8H11N3O
InChI:InChI=1/C8H11N3O/c9-7(4-8(10)12)6-2-1-3-11-5-6/h1-3,5,7H,4,9H2,(H2,10,12)
Synonyms:- 3-pyridinepropanamide, β-amino-
- 3-amino-3-(pyridin-3-yl)propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
