
CAS 77156-13-9
:1-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-3-methyl-9H-carbazol-2-ol
Description:
1-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-3-methyl-9H-carbazol-2-ol, with the CAS number 77156-13-9, is a complex organic compound characterized by its unique structure that combines a carbazole moiety with a long aliphatic side chain. This compound features a hydroxyl group (-OH) attached to the carbazole, which contributes to its potential as a bioactive molecule. The presence of the dimethylated octadienyl group suggests that it may exhibit interesting chemical reactivity and possibly biological activity, such as antioxidant or antimicrobial properties. The molecular structure indicates that it may be lipophilic due to the hydrophobic alkyl chain, which could influence its solubility and interaction with biological membranes. Additionally, the compound's conjugated system may allow for electronic transitions, making it of interest in studies related to photochemistry or materials science. Overall, this compound's unique characteristics make it a subject of interest in various fields, including organic chemistry, pharmacology, and materials science.
Formula:C23H27NO
InChI:InChI=1S/C23H27NO/c1-15(2)8-7-9-16(3)12-13-19-22-20(14-17(4)23(19)25)18-10-5-6-11-21(18)24-22/h5-6,8,10-12,14,24-25H,7,9,13H2,1-4H3/b16-12+
InChI key:InChIKey=JSSIAXXILAGJKE-FOWTUZBSSA-N
SMILES:C(/C=C(/CCC=C(C)C)\C)C1=C2C(C=3C(N2)=CC=CC3)=CC(C)=C1O
Synonyms:- 1-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-3-methyl-9H-carbazol-2-ol
- 9H-Carbazol-2-ol, 1-(3,7-dimethyl-2,6-octadienyl)-3-methyl-, (E)-
- Mahanimbinol
- 9H-Carbazol-2-ol, 1-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-3-methyl-
- 9H-Carbazol-2-ol, 1-[(2E)-3,7-dimethyl-2,6-octadienyl]-3-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
9H-Carbazol-2-ol, 1-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-3-methyl-
CAS:Formula:C23H27NOPurity:95.0%Molecular weight:333.4666Mahanimbilol
CAS:Mahanimbilol is a natural product for research related to life sciences. The catalog number is TN6099 and the CAS number is 77156-13-9.Formula:C23H27NOPurity:98%Color and Shape:SolidMolecular weight:333.47Mahanimbilol
CAS:Mahanimbilol is a limonoid compound, which is primarily derived from the leaves of the curry tree, scientifically known as *Murraya koenigii*. This compound is sourced from the plant through extraction processes that isolate the bioactive components inherent to the leaves. Mahanimbilol exhibits its mode of action through various biochemical pathways, including modulation of oxidative stress and regulation of enzyme activity associated with inflammation and cell proliferation.Formula:C23H27NOPurity:Min. 95%Molecular weight:333.5 g/mol


