CymitQuimica logo

CAS 771572-97-5

:

3-Fluoro-4-nitrobenzeneethanamine

Description:
3-Fluoro-4-nitrobenzeneethanamine, with the CAS number 771572-97-5, is an organic compound characterized by the presence of both a fluorine atom and a nitro group attached to a benzene ring, along with an ethylamine side chain. This compound features a fluorobenzene moiety, which can influence its reactivity and physical properties due to the electronegative fluorine atom. The nitro group, known for its electron-withdrawing properties, can enhance the compound's reactivity in electrophilic aromatic substitution reactions. The ethylamine group contributes to the compound's basicity and potential for forming hydrogen bonds, which can affect its solubility in various solvents. Typically, compounds like this may exhibit moderate to high polarity, making them soluble in polar solvents. Additionally, the presence of both the nitro and amino functional groups suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.
Formula:C8H9FN2O2
InChI:InChI=1S/C8H9FN2O2/c9-7-5-6(3-4-10)1-2-8(7)11(12)13/h1-2,5H,3-4,10H2
InChI key:InChIKey=WIHIFKUCMARNNC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(F)C=C(CCN)C=C1
Synonyms:
  • Benzeneethanamine, 3-fluoro-4-nitro-
  • 3-Fluoro-4-nitrobenzeneethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.