CAS 771572-98-6
:3-(3,5-dimethyl-1,2-oxazol-4-yl)propan-1-amine
Description:
3-(3,5-dimethyl-1,2-oxazol-4-yl)propan-1-amine, with the CAS number 771572-98-6, is an organic compound characterized by its oxazole ring and an amine functional group. The presence of the oxazole moiety contributes to its potential biological activity, as oxazoles are often found in various pharmaceuticals and agrochemicals. The compound features a propan-1-amine backbone, which indicates that it has a primary amine group, making it capable of forming hydrogen bonds and participating in various chemical reactions. The dimethyl substitutions on the oxazole ring enhance its lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound may exhibit interesting pharmacological properties, although specific biological activities would depend on further studies. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, safety and handling precautions should be observed due to the presence of the amine group, which can be reactive.
Formula:C8H14N2O
InChI:InChI=1/C8H14N2O/c1-6-8(4-3-5-9)7(2)11-10-6/h3-5,9H2,1-2H3
SMILES:Cc1c(CCCN)c(C)on1
Synonyms:- 4-Isoxazolepropanamine, 3,5-Dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
