
CAS 771573-03-6
:2-(Aminomethyl)-5-fluorobenzoic acid
Description:
2-(Aminomethyl)-5-fluorobenzoic acid, with the CAS number 771573-03-6, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both an amino group and a fluorine atom. The presence of the amino group (-NH2) indicates that it can participate in various chemical reactions, such as forming amides or undergoing electrophilic substitution. The fluorine atom, being highly electronegative, can influence the compound's reactivity and polarity, potentially enhancing its biological activity. This compound is likely to be a solid at room temperature, exhibiting moderate solubility in polar solvents due to the carboxylic acid functional group. Its unique structure may contribute to specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, 2-(Aminomethyl)-5-fluorobenzoic acid is a versatile compound with potential applications in drug development and chemical synthesis.
Formula:C8H8FNO2
InChI:InChI=1S/C8H8FNO2/c9-6-2-1-5(4-10)7(3-6)8(11)12/h1-3H,4,10H2,(H,11,12)
InChI key:InChIKey=LLFSJWLFDVZKOK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(CN)C=CC(F)=C1
Synonyms:- 2-(Aminomethyl)-5-fluorobenzoic acid
- Benzoic acid, 2-(aminomethyl)-5-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.