CAS 771573-25-2

1-(2-furan-2-ylphenyl)methanamine

Description:

1-(2-Furan-2-ylphenyl)methanamine, with the CAS number 771573-25-2, is an organic compound characterized by its unique structure that includes a furan ring and an amine group. This compound features a phenyl group substituted with a furan moiety, which contributes to its potential biological activity and chemical reactivity. The presence of the amine functional group suggests that it can participate in hydrogen bonding and may exhibit basic properties. The furan ring, known for its aromaticity and electron-rich nature, can engage in various chemical reactions, including electrophilic substitutions. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its interaction with biological targets. Additionally, its solubility and stability in different solvents can vary, impacting its application in research and development. Overall, 1-(2-furan-2-ylphenyl)methanamine represents a versatile scaffold for further exploration in synthetic and pharmaceutical chemistry.

Formula: C₁₁H₁₁NO

InChI: InChI=1/C11H11NO/c12-8-9-4-1-2-5-10(9)11-6-3-7-13-11/h1-7H,8,12H2

SMILES: c1ccc(c(c1)CN)c1ccco1

Synonyms:

• [2-(2-Furyl)Phenyl]Methylamine

[2-(Fur-2-yl)phenyl]methylamine

CAS: 771573-25-2

[2-(Fur-2-yl)phenyl]methylamine

Purity: 97%

Color and Shape: Yellow Liquid

Molecular weight: 173.21g/mol

Ref: 54-OR9675