CymitQuimica logo

CAS 771573-48-9

:

2,3-Pyrazinedimethanamine

Description:
2,3-Pyrazinedimethanamine, with the CAS number 771573-48-9, is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at the 2 and 3 positions. This compound features two methanamine groups attached to the pyrazine ring, contributing to its amine functionality. It is typically a colorless to light yellow solid or liquid, depending on its purity and form. The presence of amine groups makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its solubility in polar solvents, such as water and alcohols, is notable due to the ability of the amine groups to engage in hydrogen bonding. 2,3-Pyrazinedimethanamine may have applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate potential hazards associated with amines.
Formula:C6H10N4
InChI:InChI=1S/C6H10N4/c7-3-5-6(4-8)10-2-1-9-5/h1-2H,3-4,7-8H2
InChI key:InChIKey=FTTWVEGNDHOQMZ-UHFFFAOYSA-N
SMILES:C(N)C=1C(CN)=NC=CN1
Synonyms:
  • 2,3-Pyrazinedimethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.