CAS 771574-00-6

4-Fluoro-2-methylbenzylamine

Description:

4-Fluoro-2-methylbenzylamine is an organic compound characterized by the presence of a fluorine atom and a methyl group attached to a benzylamine structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and fluorine atoms, reflecting its aromatic nature due to the benzene ring. The compound features a primary amine functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The fluorine substituent can influence the compound's electronic properties, potentially enhancing its biological activity or altering its interaction with biological targets. Additionally, the presence of the methyl group can affect steric hindrance and solubility. 4-Fluoro-2-methylbenzylamine may be used in the development of pharmaceuticals, agrochemicals, or as an intermediate in various chemical reactions. As with many amines, it may exhibit basic properties and can participate in hydrogen bonding, influencing its physical properties such as boiling point and solubility in different solvents. Safety data should be consulted for handling and storage, as amines can be hazardous.

Formula: C₈H₁₀FN

InChI: InChI=1/C8H10FN/c1-6-4-8(9)3-2-7(6)5-10/h2-4H,5,10H2,1H3

SMILES: Cc1cc(ccc1CN)F

Synonyms:

• 1-(4-Fluoro-2-methylphenyl)methanamine
• 771574-00-6
• Z1R Df B1

4-Fluoro-2-Methylbenzylamine

CAS: 771574-00-6

Formula: C₈H₁₀FN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 139.1701

Ref: IN-DA003LDD

4-Fluoro-2-methylbenzylamine

CAS: 771574-00-6

4-Fluoro-2-methylbenzylamine

Formula: C₈H₁₀FN

Purity: 97%

Color and Shape: colourless/clear liquid

Molecular weight: 139.17g/mol

Ref: 54-PC302111

4-Fluoro-2-methylbenzyl amine

CAS: 771574-00-6

Formula: C₈H₁₀FN

Purity: 97%

Color and Shape: Liquid

Molecular weight: 139.173

Ref: 10-F075557