
CAS 771579-16-9
:3-(Bromomethyl)benzenemethanamine
Description:
3-(Bromomethyl)benzenemethanamine, with the CAS number 771579-16-9, is an organic compound characterized by the presence of a bromomethyl group and an amine functional group attached to a benzene ring. This compound features a benzene ring substituted at the 3-position with a bromomethyl group, which enhances its reactivity due to the presence of the bromine atom. The amine group contributes to its basicity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions, including nucleophilic substitutions. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amine functionality. Its reactivity can be influenced by the electron-withdrawing nature of the bromine atom, which can affect the overall electronic properties of the molecule. 3-(Bromomethyl)benzenemethanamine may find applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in the preparation of more complex chemical entities.
Formula:C8H10BrN
InChI:InChI=1S/C8H10BrN/c9-5-7-2-1-3-8(4-7)6-10/h1-4H,5-6,10H2
InChI key:InChIKey=RLVCIPWFASWVHQ-UHFFFAOYSA-N
SMILES:C(Br)C1=CC(CN)=CC=C1
Synonyms:- 3-(Bromomethyl)benzenemethanamine
- [3-(Bromomethyl)phenyl]methanamine
- Benzenemethanamine, 3-(bromomethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
