CAS 771579-32-9

2-Fluoro-6-iodobenzenemethanamine

Description:

2-Fluoro-6-iodobenzenemethanamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a fluorine and an iodine atom, as well as an amine group. The presence of the fluorine atom at the 2-position and the iodine at the 6-position of the benzene ring contributes to its unique reactivity and potential applications in medicinal chemistry and material science. The amine group, which is a key functional group, can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may exhibit interesting biological activities due to the halogen substituents, which can influence its interaction with biological targets. Additionally, its molecular structure suggests that it may have specific solubility and stability characteristics, making it suitable for various synthetic applications. As with many halogenated compounds, safety considerations regarding its handling and disposal are important due to potential toxicity and environmental impact.

Formula: C₇H₇FIN

InChI: InChI=1S/C7H7FIN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H,4,10H2

InChI key: InChIKey=FYXZRUMWEIPHKL-UHFFFAOYSA-N

SMILES: C(N)C1=C(F)C=CC=C1I

Synonyms:

• Benzenemethanamine, 2-fluoro-6-iodo-
• 6-Fluoro-2-iodobenzylamine
• (2-Fluoro-6-iodophenyl)methanamine
• 2-Fluoro-6-iodobenzenemethanamine
• (2-Fluoro-6-iodobenzyl)amine