CymitQuimica logo

CAS 771579-61-4

:

3-Amino-1-(2-chlorophenyl)-1-propanone

Description:
3-Amino-1-(2-chlorophenyl)-1-propanone, identified by its CAS number 771579-61-4, is an organic compound characterized by the presence of an amino group and a ketone functional group. This compound features a propanone backbone with a 2-chlorophenyl substituent, which contributes to its unique chemical properties. The amino group (-NH2) typically imparts basicity and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the chlorophenyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential reactivity under certain conditions, such as electrophilic aromatic substitution due to the electron-withdrawing nature of the chlorine atom. Overall, 3-Amino-1-(2-chlorophenyl)-1-propanone is a versatile compound that may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research and development.
Formula:C9H10ClNO
InChI:InChI=1S/C9H10ClNO/c10-8-4-2-1-3-7(8)9(12)5-6-11/h1-4H,5-6,11H2
InChI key:InChIKey=BISCTLDHFLGLOV-UHFFFAOYSA-N
SMILES:C(CCN)(=O)C1=C(Cl)C=CC=C1
Synonyms:
  • 1-Propanone, 3-amino-1-(2-chlorophenyl)-
  • 3-Amino-1-(2-chlorophenyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.