
CAS 771580-15-5
:2,4,5-Trifluorobenzeneethanamine
Description:
2,4,5-Trifluorobenzeneethanamine is an organic compound characterized by the presence of a benzene ring substituted with three fluorine atoms at the 2, 4, and 5 positions, along with an ethylamine group. This compound is notable for its fluorinated structure, which can significantly influence its chemical reactivity, polarity, and biological activity. The trifluoromethyl groups enhance the compound's lipophilicity and may affect its interaction with biological targets, making it of interest in medicinal chemistry and material science. The presence of the amine functional group suggests potential for hydrogen bonding and reactivity in various chemical reactions, including nucleophilic substitutions. Additionally, the compound's physical properties, such as boiling point and solubility, are influenced by the fluorine substituents, which can alter intermolecular forces. Safety and handling considerations are important due to the potential toxicity associated with fluorinated compounds. Overall, 2,4,5-Trifluorobenzeneethanamine represents a unique structure with diverse applications in research and industry.
Formula:C8H8F3N
InChI:InChI=1S/C8H8F3N/c9-6-4-8(11)7(10)3-5(6)1-2-12/h3-4H,1-2,12H2
InChI key:InChIKey=CASLOKJJRHKAFN-UHFFFAOYSA-N
SMILES:C(CN)C1=C(F)C=C(F)C(F)=C1
Synonyms:- Benzeneethanamine, 2,4,5-trifluoro-
- 2,4,5-Trifluorobenzeneethanamine
- 2-(2,4,5-Trifluorophenyl)ethanamine
- 2-(2,4,5-Trifluorophenyl)ethan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.