CAS 771580-16-6

2,4,6-Trifluorobenzeneethanamine

Description:

2,4,6-Trifluorobenzeneethanamine, identified by its CAS number 771580-16-6, is an organic compound characterized by the presence of a trifluoromethyl group attached to a benzene ring and an ethylamine functional group. This compound features a benzene ring substituted at the 2, 4, and 6 positions with fluorine atoms, which significantly influences its chemical properties, including increased electronegativity and potential reactivity. The presence of the amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions, including nucleophilic substitutions. The trifluoromethyl groups enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry and material science. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the fluorine substituents, which can alter its interaction with other chemical species. Overall, 2,4,6-Trifluorobenzeneethanamine is a versatile compound with potential applications in pharmaceuticals and agrochemicals.

Formula: C₈H₈F₃N

InChI: InChI=1S/C8H8F3N/c9-5-3-7(10)6(1-2-12)8(11)4-5/h3-4H,1-2,12H2

InChI key: InChIKey=ODNMAXBOJVAYMM-UHFFFAOYSA-N

SMILES: C(CN)C1=C(F)C=C(F)C=C1F

Synonyms:

• 2,4,6-Trifluorobenzeneethanamine
• 2-(2,4,6-Trifluorophenyl)ethan-1-amine
• Benzeneethanamine, 2,4,6-trifluoro-
• 2-(2,4,6-Trifluoro-phenyl)-ethylamine