CAS 771581-04-5

4-Nitro-2-pyridinemethanamine

Description:

4-Nitro-2-pyridinemethanamine, with the CAS number 771581-04-5, is an organic compound that features a pyridine ring substituted with both an amino group and a nitro group. This compound is characterized by its aromatic nature due to the presence of the pyridine ring, which contributes to its chemical stability and reactivity. The amino group (-NH2) provides basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The nitro group (-NO2) is an electron-withdrawing group, which can influence the compound's reactivity and polarity. Typically, compounds like this may exhibit moderate solubility in polar solvents due to the presence of the amino group, while the nitro group can enhance the compound's reactivity towards electrophiles. Additionally, 4-Nitro-2-pyridinemethanamine may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research and development. Safety data should be consulted for handling and usage, as nitro compounds can pose health risks.

Formula: C₆H₇N₃O₂

InChI: InChI=1S/C6H7N3O2/c7-4-5-3-6(9(10)11)1-2-8-5/h1-3H,4,7H2

InChI key: InChIKey=IRXZAESUDRFBDZ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(CN)N=CC1

Synonyms:

• 4-Nitro-2-pyridinemethanamine
• (4-Nitropyridin-2-yl)methanamine
• 2-Pyridinemethanamine, 4-nitro-