CAS 771581-11-4

4-(Aminomethyl)-2-fluorophenol

Description:

4-(Aminomethyl)-2-fluorophenol, with the CAS number 771581-11-4, is an organic compound characterized by the presence of both an amino group and a fluorine atom attached to a phenolic structure. This compound features a fluorine atom at the 2-position and an aminomethyl group at the 4-position of the phenol ring, which influences its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl and amino functional groups. The presence of the fluorine atom can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the reactivity of the amino and hydroxyl groups. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₈FNO

InChI: InChI=1S/C7H8FNO/c8-6-3-5(4-9)1-2-7(6)10/h1-3,10H,4,9H2

InChI key: InChIKey=IYXYEJVZFHQIHQ-UHFFFAOYSA-N

SMILES: C(N)C1=CC(F)=C(O)C=C1

Synonyms:

• Phenol, 4-(aminomethyl)-2-fluoro-
• 4-(Aminomethyl)-2-fluorophenol
• 2: PN: WO2022170155 PAGE: 246 claimed sequence