CAS 771581-48-7
:4-(1-Piperazinyl)benzenemethanamine
Description:
4-(1-Piperazinyl)benzenemethanamine, also known by its CAS number 771581-48-7, is a chemical compound characterized by its piperazine and benzene moieties. This substance typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the amine functional group. The compound features a piperazine ring, which contributes to its potential biological activity, particularly in pharmacological applications. It may exhibit properties such as being a ligand for various receptors, making it of interest in medicinal chemistry. The presence of the amine group suggests it can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. Additionally, the compound's structure allows for potential modifications, which can lead to derivatives with varied biological activities. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H17N3
InChI:InChI=1S/C11H17N3/c12-9-10-1-3-11(4-2-10)14-7-5-13-6-8-14/h1-4,13H,5-9,12H2
InChI key:InChIKey=AMMWIBNKEHSGDR-UHFFFAOYSA-N
SMILES:C(N)C1=CC=C(C=C1)N2CCNCC2
Synonyms:- Benzenemethanamine, 4-(1-piperazinyl)-
- 1-[4-(Piperazin-1-yl)phenyl]methanamine
- [4-(Piperazin-1-yl)phenyl]methanamine
- 4-(1-Piperazinyl)benzenemethanamine
- (4-Piperazin-1-ylphenyl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.