CAS 771582-59-3

3-Fluoro-5-iodobenzenemethanamine

Description:

3-Fluoro-5-iodobenzenemethanamine, with the CAS number 771582-59-3, is an organic compound characterized by the presence of both fluorine and iodine substituents on a benzene ring, along with an amine functional group. This compound features a benzene ring with a fluorine atom at the meta position (3-position) and an iodine atom at the para position (5-position) relative to the amine group. The presence of these halogens can significantly influence the compound's reactivity, polarity, and overall chemical behavior. The amine group contributes basic properties and can participate in hydrogen bonding, affecting solubility in polar solvents. Additionally, the halogen substituents may enhance the compound's potential for electrophilic aromatic substitution reactions. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with halogenated aromatic amines. However, specific safety and handling guidelines should be followed, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.

Formula: C₇H₇FIN

InChI: InChI=1S/C7H7FIN/c8-6-1-5(4-10)2-7(9)3-6/h1-3H,4,10H2

InChI key: InChIKey=LBMYMISEQXDLFV-UHFFFAOYSA-N

SMILES: C(N)C1=CC(F)=CC(I)=C1

Synonyms:

• Benzenemethanamine, 3-fluoro-5-iodo-
• 3-Fluoro-5-iodobenzenemethanamine