CAS 771582-60-6

3-Chloro-2-methyl-1-propanamine

Description:

3-Chloro-2-methyl-1-propanamine, with the CAS number 771582-60-6, is an organic compound characterized by its amine functional group and a chloro substituent. This compound features a three-carbon chain with a methyl group and a chlorine atom attached to the second carbon, contributing to its unique reactivity and properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the amine group indicates that it can act as a nucleophile in various chemical reactions, making it useful in organic synthesis. Additionally, the chlorine atom can participate in substitution reactions, enhancing its versatility in forming other compounds. Due to its structure, 3-Chloro-2-methyl-1-propanamine may exhibit moderate solubility in polar solvents and can engage in hydrogen bonding due to the amine group. Safety considerations should be taken into account when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₄H₁₀ClN

InChI: InChI=1S/C4H10ClN/c1-4(2-5)3-6/h4H,2-3,6H2,1H3

InChI key: InChIKey=IHYMTVGUOZKLFK-UHFFFAOYSA-N

SMILES: C(CCl)(CN)C

Synonyms:

• 3-Chloro-2-methyl-1-propanamine
• 1-Propanamine, 3-chloro-2-methyl-