
CAS 771582-62-8
:Ethanol, 2-amino-, 1-benzenesulfonate
Description:
Ethanol, 2-amino-, 1-benzenesulfonate, also known by its CAS number 771582-62-8, is a chemical compound characterized by the presence of an amino group and a sulfonate group attached to a benzene ring. This compound typically exhibits properties associated with both amines and sulfonates, including potential solubility in polar solvents due to the hydrophilic nature of the sulfonate group. The amino group can participate in hydrogen bonding, enhancing its reactivity and interaction with other molecules. Ethanol, 2-amino-, 1-benzenesulfonate may be used in various applications, including as a reagent in organic synthesis or as a potential intermediate in the production of pharmaceuticals. Its structural features suggest it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as compounds with amino and sulfonate functionalities can have specific toxicity and environmental considerations. Overall, this compound represents a unique combination of functional groups that can be leveraged in chemical research and applications.
Formula:C8H11NO3S
InChI:InChI=1S/C8H11NO3S/c9-6-7-12-13(10,11)8-4-2-1-3-5-8/h1-5H,6-7,9H2
InChI key:InChIKey=XYVHEUSANQHYFS-UHFFFAOYSA-N
SMILES:S(OCCN)(=O)(=O)C1=CC=CC=C1
Synonyms:- Ethanol, 2-amino-, 1-benzenesulfonate
- 2-Aminoethyl benzenesulfonate
- Ethanol, 2-amino-, benzenesulfonate (ester)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
