CAS 771582-88-8

1-(4-Methylphenyl)cyclohexanemethanamine

Description:

1-(4-Methylphenyl)cyclohexanemethanamine, also known by its CAS number 771582-88-8, is an organic compound characterized by its amine functional group and a cyclohexane ring structure. This compound features a 4-methylphenyl group attached to a cyclohexanemethanamine backbone, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the amine group suggests potential basicity and reactivity, particularly in forming salts with acids. Additionally, the aromatic methyl group can influence the compound's electronic properties and steric hindrance, affecting its interactions in biological systems or chemical reactions. As with many amines, it may also participate in hydrogen bonding, which can impact its physical properties such as boiling and melting points. Safety and handling precautions should be observed, as amines can be irritants and may have specific regulatory considerations in various applications.

Formula: C₁₄H₂₁N

InChI: InChI=1S/C14H21N/c1-12-5-7-13(8-6-12)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-11,15H2,1H3

InChI key: InChIKey=FVVRLVQDXAZMHZ-UHFFFAOYSA-N

SMILES: C(N)C1(CCCCC1)C2=CC=C(C)C=C2

Synonyms:

• ((1-p-Tolylcyclohexyl)methyl)amine
• 1-(4-Methylphenyl)cyclohexanemethanamine
• Cyclohexanemethanamine, 1-(4-methylphenyl)-
• [1-(4-Methylphenyl)cyclohexyl]methanamine
• [1-(4-Methylphenyl)cyclohexyl]methylamine