CAS 771583-25-6

1-(2-Chloro-4-fluorophenyl)cyclopentanemethanamine

Description:

1-(2-Chloro-4-fluorophenyl)cyclopentanemethanamine, with the CAS number 771583-25-6, is a chemical compound characterized by its unique structure, which includes a cyclopentanemethanamine moiety attached to a phenyl ring that is substituted with both a chlorine and a fluorine atom. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of halogen substituents (chlorine and fluorine) can significantly affect the compound's electronic properties, potentially enhancing its lipophilicity and altering its biological activity. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's structural features may contribute to its potential interactions with biological targets, making it a candidate for further investigation in drug discovery and development. As with many organic compounds, safety and handling precautions should be observed due to the presence of halogens and the amine functional group.

Formula: C₁₂H₁₅ClFN

InChI: InChI=1S/C12H15ClFN/c13-11-7-9(14)3-4-10(11)12(8-15)5-1-2-6-12/h3-4,7H,1-2,5-6,8,15H2

InChI key: InChIKey=FWJHJPZXPUJOOW-UHFFFAOYSA-N

SMILES: C(N)C1(CCCC1)C2=C(Cl)C=C(F)C=C2

Synonyms:

• 1-(2-Chloro-4-fluorophenyl)cyclopentanemethanamine
• Cyclopentanemethanamine, 1-(2-chloro-4-fluorophenyl)-