
CAS 771583-28-9
:1-(2-Chloro-6-fluorophenyl)cyclohexanemethanamine
Description:
1-(2-Chloro-6-fluorophenyl)cyclohexanemethanamine, with the CAS number 771583-28-9, is a chemical compound characterized by its unique structure, which includes a cyclohexane ring and an amine functional group. This compound features a phenyl ring substituted with both a chlorine and a fluorine atom, contributing to its potential biological activity and chemical reactivity. The presence of the amine group suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the phenyl ring can significantly affect the compound's efficacy and selectivity. Additionally, the halogen substituents may enhance lipophilicity and metabolic stability. Overall, the characteristics of this compound make it a subject of interest in various fields, including drug development and materials science.
Formula:C13H17ClFN
InChI:InChI=1S/C13H17ClFN/c14-10-5-4-6-11(15)12(10)13(9-16)7-2-1-3-8-13/h4-6H,1-3,7-9,16H2
InChI key:InChIKey=XXURAZAUDLATIH-UHFFFAOYSA-N
SMILES:C(N)C1(C2=C(Cl)C=CC=C2F)CCCCC1
Synonyms:- 1-(2-Chloro-6-fluorophenyl)cyclohexanemethanamine
- Cyclohexanemethanamine, 1-(2-chloro-6-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.