CymitQuimica logo

CAS 771583-81-4

:

4-Chloro-2-(trifluoromethyl)benzylamine

Description:
4-Chloro-2-(trifluoromethyl)benzylamine is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with a chlorine atom and a trifluoromethyl group. The presence of the amino group (-NH2) attached to the benzyl moiety enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group. Its trifluoromethyl group contributes to its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. The chlorine and trifluoromethyl substituents can also affect the electronic properties of the molecule, potentially enhancing its reactivity or altering its interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4-Chloro-2-(trifluoromethyl)benzylamine is a versatile compound with applications in various fields of chemistry.
Formula:C8H7ClF3N
InChI:InChI=1S/C8H7ClF3N/c9-6-2-1-5(4-13)7(3-6)8(10,11)12/h1-3H,4,13H2
InChI key:VPKIGWHSTBKRTA-UHFFFAOYSA-N
SMILES:c1cc(cc(c1CN)C(F)(F)F)Cl
Synonyms:
  • 1-[4-Chloro-2-(trifluoromethyl)phenyl]methanamine
Found 4 products.