
CAS 771583-82-5
:2-Fluoro-4-(trifluoromethyl)benzeneethanamine
Description:
2-Fluoro-4-(trifluoromethyl)benzeneethanamine, with the CAS number 771583-82-5, is an organic compound characterized by its aromatic structure and the presence of both fluorine and amine functional groups. This compound features a benzene ring substituted with a trifluoromethyl group and a fluoro group, which significantly influence its chemical properties, including reactivity and polarity. The amine group contributes to its potential as a base and its ability to participate in hydrogen bonding. The presence of multiple fluorine atoms enhances the compound's lipophilicity and may affect its biological activity, making it of interest in pharmaceutical research. Additionally, the compound's unique structure may impart specific electronic properties, influencing its behavior in various chemical reactions. Overall, 2-Fluoro-4-(trifluoromethyl)benzeneethanamine is a fluorinated aromatic amine that may have applications in medicinal chemistry and materials science, although detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C9H9F4N
InChI:InChI=1S/C9H9F4N/c10-8-5-7(9(11,12)13)2-1-6(8)3-4-14/h1-2,5H,3-4,14H2
InChI key:InChIKey=ZERSTGLGQNKGSN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(F)=C(CCN)C=C1
Synonyms:- Benzeneethanamine, 2-fluoro-4-(trifluoromethyl)-
- 2-(2-Fluoro-4-(trifluoromethyl)phenyl)ethanamine
- 2-Fluoro-4-(trifluoromethyl)benzeneethanamine
- 2-[2-Fluoro-4-(trifluoromethyl)phenyl]ethan-1-amine
- 2-(2-Fluoro-4-trifluoromethylphenyl)ethylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.