
CAS 7716-59-8
:1,2-Benzisothiazol-3-amine, N-ethyl-, hydrochloride (1:1)
Description:
1,2-Benzisothiazol-3-amine, N-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzisothiazole moiety and an ethylamine group. This compound typically appears as a crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. It is often used in various applications, including as a reagent in organic synthesis and potentially in the development of pharmaceuticals. The presence of the benzisothiazole ring contributes to its biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects can vary based on the context of use. Safety data should be consulted, as with any chemical, to understand its handling, toxicity, and environmental impact. Overall, 1,2-Benzisothiazol-3-amine, N-ethyl-, hydrochloride is a versatile compound with potential applications in research and industry.
Formula:C9H10N2S·ClH
InChI:InChI=1S/C9H10N2S.ClH/c1-2-10-9-7-5-3-4-6-8(7)12-11-9;/h3-6H,2H2,1H3,(H,10,11);1H
InChI key:InChIKey=SZWACMABFMCJPV-UHFFFAOYSA-N
SMILES:N(CC)C=1C=2C(SN1)=CC=CC2.Cl
Synonyms:- 1,2-Benzisothiazol-3-amine, N-ethyl-, monohydrochloride
- Etisazole hydrochloride
- 1,2-Benzisothiazole, 3-(ethylamino)-, monohydrochloride
- 1,2-Benzisothiazol-3-amine, N-ethyl-, hydrochloride (1:1)
- 1,2-Benzisothiazole, 3-(ethylamino)-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
