CAS 7716-60-1
:Etisazole
Description:
Etisazole, with the CAS number 7716-60-1, is a chemical compound that belongs to the class of azole derivatives. It is primarily recognized for its use as an antifungal agent, particularly in veterinary medicine. The compound exhibits a broad spectrum of activity against various fungal pathogens, making it valuable in treating fungal infections. Etisazole is characterized by its ability to inhibit the synthesis of ergosterol, a crucial component of fungal cell membranes, thereby disrupting fungal growth and replication. The substance is typically administered in specific formulations, and its efficacy can be influenced by factors such as dosage and the specific type of fungal infection being treated. Additionally, like many azole compounds, Etisazole may have potential side effects and interactions, necessitating careful consideration in its use. Its chemical structure includes a five-membered ring containing nitrogen atoms, which is a common feature among azole antifungals, contributing to its biological activity.
Formula:C9H10N2S
InChI:InChI=1S/C9H10N2S/c1-2-10-9-7-5-3-4-6-8(7)12-11-9/h3-6H,2H2,1H3,(H,10,11)
InChI key:InChIKey=CPYSWRYVSINXMC-UHFFFAOYSA-N
SMILES:N(CC)C=1C=2C(SN1)=CC=CC2
Synonyms:- 1,2-Benzisothiazol-3-amine, N-ethyl-
- Etisazol
- Etisazole
- N-Ethyl-1,2-benzisothiazol-3-amine
- 1,2-Benzisothiazole, 3-(ethylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
