CAS 77162-47-1
:3-amino-4-fluorobutanoic acid
Description:
3-Amino-4-fluorobutanoic acid, with the CAS number 77162-47-1, is an amino acid derivative characterized by the presence of both an amino group (-NH2) and a fluorine atom attached to a four-carbon butanoic acid backbone. This compound features a chiral center, which can lead to the existence of enantiomers. It is typically a white to off-white solid at room temperature and is soluble in water due to the polar nature of its functional groups. The presence of the fluorine atom can influence its biological activity and chemical reactivity, making it of interest in pharmaceutical research and development. As an amino acid analog, it may participate in various biochemical pathways and could potentially serve as a building block for peptide synthesis or as a tool in studying amino acid transport mechanisms. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other substances in the environment.
Formula:C4H8FNO2
InChI:InChI=1/C4H8FNO2/c5-2-3(6)1-4(7)8/h3H,1-2,6H2,(H,7,8)
SMILES:C(C(CF)N)C(=O)O
Synonyms:- Butanoic Acid, 3-Amino-4-Fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.