CAS 77168-31-1
:4-chloro-6-methyl-2-pyridin-2-ylpyrimidine
Description:
4-Chloro-6-methyl-2-pyridin-2-ylpyrimidine is a heterocyclic organic compound characterized by its pyrimidine and pyridine rings, which contribute to its biological activity and chemical properties. The presence of a chlorine atom at the 4-position and a methyl group at the 6-position of the pyrimidine ring enhances its lipophilicity and potential reactivity. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the chlorine atom. Additionally, 4-chloro-6-methyl-2-pyridin-2-ylpyrimidine has garnered interest in medicinal chemistry for its potential pharmacological applications, particularly in the development of pharmaceuticals targeting specific biological pathways. Its structural features allow for interactions with biological macromolecules, making it a candidate for further research in drug discovery and development.
Formula:C10H8ClN3
InChI:InChI=1/C10H8ClN3/c1-7-6-9(11)14-10(13-7)8-4-2-3-5-12-8/h2-6H,1H3
SMILES:Cc1cc(Cl)nc(c2ccccn2)n1
Synonyms:- 4-Chloro-2-(2-pyridyl)-6-methylpyrimidine
- 4-Chloro-6-methyl-2-(2-pyridinyl)pyrimidine
- Pyrimidine, 4-chloro-6-methyl-2-(2-pyridinyl)-
- T6N Cnj Dg F1 B- Bt6Nj
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Chloro-6-methyl-2-(pyridin-2-yl)pyrimidine
CAS:4-Chloro-6-methyl-2-(pyridin-2-yl)pyrimidinePurity:95%Molecular weight:205.64g/mol4-Chloro-6-methyl-2-(2-pyridinyl)pyrimidine
CAS:4-Chloro-6-methyl-2-(2-pyridinyl)pyrimidine is a crossover high spin ligand, with a mononuclear low spin transition state. This ligand has been shown to bind to the Fe site of the enzyme cytochrome c oxidase by forming an interaction with the heme and the protein. This interaction results in a hysteretic, isomeric ligand that binds reversibly to the Fe site. 4-Chloro-6-methyl-2-(2-pyridinyl)pyrimidine has been found to be autocatalytic in some cases, but this effect can be overcome by using a higher concentration of ligand.
Formula:C10H8ClN3Purity:Min. 95%Molecular weight:205.65 g/mol


