CAS 77168-37-7
:2-[2-(Methylthio)-4-pyrimidinyl]propanedial
Description:
2-[2-(Methylthio)-4-pyrimidinyl]propanedial, with the CAS number 77168-37-7, is a chemical compound characterized by its pyrimidine ring structure, which is substituted with a methylthio group and a propanedial moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the pyrimidine ring, which is known for its role in various biochemical processes. The methylthio group may influence the compound's solubility and reactivity, while the propanedial functional group suggests the presence of aldehyde functionalities, which can participate in various chemical reactions, such as condensation and nucleophilic addition. The compound's molecular structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, 2-[2-(Methylthio)-4-pyrimidinyl]propanedial represents a unique structure with potential applications in research and development.
Formula:C8H8N2O2S
InChI:InChI=1S/C8H8N2O2S/c1-13-8-9-3-2-7(10-8)6(4-11)5-12/h2-6H,1H3
InChI key:InChIKey=ARQRGYFOBLEOBL-UHFFFAOYSA-N
SMILES:C(C=O)(C=O)C1=NC(SC)=NC=C1
Synonyms:- 2-(2-Methanesulfanylpyrimidin-4-yl)malonaldehyde
- 2-[2-(Methylthio)-4-pyrimidinyl]propanedial
- Propanedial, 2-[2-(Methylthio)-4-Pyrimidinyl]-
- Propanedial, [2-(methylthio)-4-pyrimidinyl]-
- [2-(Methylsulfanyl)pyrimidin-4-yl]malonaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.