CAS 77169-12-1

1,3-diphenyl-1H-pyrazole-4-carboxylate

Description:

1,3-Diphenyl-1H-pyrazole-4-carboxylate is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features two phenyl groups attached to the first and third positions of the pyrazole ring, contributing to its aromatic character and potential for various chemical interactions. The presence of a carboxylate group at the fourth position enhances its reactivity and solubility in polar solvents. This compound is often studied for its biological activities, including potential applications in pharmaceuticals and agrochemicals due to its ability to interact with biological targets. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit interesting optical properties, which can be explored in materials science. Overall, 1,3-diphenyl-1H-pyrazole-4-carboxylate is a significant compound in both synthetic and applied chemistry contexts.

Formula: C₁₆H₁₁N₂O₂

InChI: InChI=1/C16H12N2O2/c19-16(20)14-11-18(13-9-5-2-6-10-13)17-15(14)12-7-3-1-4-8-12/h1-11H,(H,19,20)/p-1

SMILES: c1ccc(cc1)c1c(cn(c2ccccc2)n1)C(=O)[O-]

1,3-Diphenyl-1 H -pyrazole-4-carboxylic acid

CAS: 77169-12-1

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 264.28399658203125

Ref: 10-F028174