CAS 77171-41-6
:N-Boc-(2R,3R)-2-Hydroxy-3-Amino-4-Phenylbutanoic Acid
Description:
N-Boc-(2R,3R)-2-Hydroxy-3-Amino-4-Phenylbutanoic Acid, with the CAS number 77171-41-6, is a chemical compound that belongs to the class of amino acids and is characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group. This compound features a chiral center, indicated by the (2R,3R) configuration, which contributes to its stereochemical properties. The molecule contains a hydroxyl group (-OH) and an amino group (-NH2), making it a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and peptides. The phenyl group attached to the butanoic acid backbone enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. N-Boc protection is commonly used in peptide synthesis to prevent unwanted reactions during the coupling process. Overall, this compound is significant in medicinal chemistry and biochemistry due to its structural features and functional groups that facilitate various chemical reactions and applications.
Formula:C15H21NO5
InChI:InChI=1/C15H21NO5/c1-15(2,3)21-14(20)16-11(12(17)13(18)19)9-10-7-5-4-6-8-10/h4-8,11-12,17H,9H2,1-3H3,(H,16,20)(H,18,19)/t11-,12-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](Cc1ccccc1)[C@@H](C(=O)O)O)O
Synonyms:- (2S,3S)-3-[(tert-butoxycarbonyl)amino]-2-hydroxy-4-phenylbutanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2R,3R)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
CAS:Formula:C15H21NO5Purity:98%Molecular weight:295.3309(2R,3R)-3-Amino-2-hydroxy-4-phenylbutanoic acid, N-BOC protected
CAS:<p>(2R,3R)-3-Amino-2-hydroxy-4-phenylbutanoic acid, N-BOC protected</p>Purity:97%Color and Shape:PowderMolecular weight:295.33g/molBoc-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid
CAS:<p>Boc-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid is a reagent and speciality chemical that is used as a building block in organic synthesis. It is a versatile intermediate that can be used to synthesize complex compounds with high quality and purity. Boc-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid has been shown to be stable under acidic conditions, making it an excellent choice for use in reactions involving strong acids. This compound can also be used as a scaffold for the synthesis of peptides and proteins.</p>Formula:C15H21NO5Purity:Min. 95%Color and Shape:PowderMolecular weight:295.33 g/mol(2R,3R)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
CAS:Formula:C15H21NO5Purity:95.0%Color and Shape:Solid, Crystalline Powder or LumpsMolecular weight:295.335




