CymitQuimica logo

CAS 77172-72-6

:

3,4,5,6-Tetrabromophenolsulfonephthalein

Description:
3,4,5,6-Tetrabromophenolsulfonephthalein, commonly known as Bromothymol Blue, is a synthetic organic compound characterized by its distinctive color-changing properties, which make it a useful pH indicator. This compound features a sulfonephthalein structure, incorporating four bromine atoms that enhance its colorimetric response. It typically exhibits a yellow color in acidic solutions and transitions to blue in alkaline conditions, making it valuable in various analytical chemistry applications, particularly in titrations and biological assays. The presence of bromine atoms contributes to its stability and solubility in organic solvents. Additionally, it is often used in microbiological and biochemical research to monitor pH changes in culture media. While generally considered safe for laboratory use, appropriate safety measures should be taken due to its synthetic nature and potential environmental impact. Overall, 3,4,5,6-Tetrabromophenolsulfonephthalein serves as an essential tool in both educational and professional settings for visualizing pH changes.
Formula:C19H10Br4O5S
InChI:InChI=1/C19H10Br4O5S/c20-14-13-18(17(23)16(22)15(14)21)29(26,27)28-19(13,9-1-5-11(24)6-2-9)10-3-7-12(25)8-4-10/h1-8,24-25H
InChI key:ARVZQGSXIKSAAY-UHFFFAOYSA-N
SMILES:c1cc(ccc1C1(c2ccc(cc2)O)c2c(c(c(c(c2S(=O)(=O)O1)Br)Br)Br)Br)O
Found 5 products.