CAS 77185-71-8

6-bromo-2-phenyl-1H-indole

Description:

6-Bromo-2-phenyl-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 6-position and a phenyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may show limited solubility in water due to its hydrophobic nature. It is often utilized in medicinal chemistry and research due to its potential biological activities, including anti-cancer and anti-inflammatory properties. The bromine substituent can enhance the compound's reactivity, making it a useful intermediate in various synthetic applications. Additionally, 6-bromo-2-phenyl-1H-indole can participate in electrophilic aromatic substitution reactions, allowing for further functionalization. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings. Overall, this compound is of interest in both academic and pharmaceutical research contexts.

Formula: C₁₄H₁₀BrN

InChI: InChI=1/C14H10BrN/c15-12-7-6-11-8-13(16-14(11)9-12)10-4-2-1-3-5-10/h1-9,16H

SMILES: c1ccc(cc1)c1cc2ccc(cc2[nH]1)Br

6-Bromo-2-phenyl-1H-indole

CAS: 77185-71-8

Formula: C₁₄H₁₀BrN

Purity: 96%

Color and Shape: Solid

Molecular weight: 272.1399

Ref: IN-DA005DD8

6-Bromo-2-phenyl-1H-indole

CAS: 77185-71-8

6-Bromo-2-phenyl-1H-indole

Purity: 98%

Ref: 54-OR1041129

6-Bromo-2-phenyl-1H-indole

CAS: 77185-71-8

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 272.1449890136719

Ref: 10-F227607