
CAS 77185-74-1
:6-Bromo-2-phenyl-1H-indole-3-carbonitrile
Description:
6-Bromo-2-phenyl-1H-indole-3-carbonitrile is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position and a phenyl group at the 2-position contributes to its unique reactivity and potential applications in medicinal chemistry. The carbonitrile functional group at the 3-position enhances its electronic properties, making it a valuable intermediate in organic synthesis. This compound is typically used in research settings, particularly in the development of pharmaceuticals, due to its potential biological activity. Its molecular structure allows for various interactions with biological targets, which can be explored for therapeutic purposes. Additionally, the compound's solubility, stability, and reactivity can vary based on the conditions under which it is handled, making it important to consider these factors in experimental applications. Safety data should be reviewed before handling, as with all chemical substances.
Formula:C15H9BrN2
InChI:InChI=1S/C15H9BrN2/c16-11-6-7-12-13(9-17)15(18-14(12)8-11)10-4-2-1-3-5-10/h1-8,18H
InChI key:InChIKey=ZDKHXNABKQCCDJ-UHFFFAOYSA-N
SMILES:C(#N)C1=C(NC=2C1=CC=C(Br)C2)C3=CC=CC=C3
Synonyms:- 1H-Indole-3-carbonitrile, 6-bromo-2-phenyl-
- 6-Bromo-2-phenyl-1H-indole-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.