CAS 77186-95-9

1,3-benzoxazol-2-ylmethanol

Description:

1,3-Benzoxazol-2-ylmethanol is an organic compound characterized by its benzoxazole structure, which consists of a fused benzene and oxazole ring. This compound features a hydroxymethyl group (-CH2OH) attached to the nitrogen of the oxazole ring, contributing to its reactivity and potential applications. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions and formulations. The presence of the hydroxymethyl group allows for hydrogen bonding, influencing its physical properties and interactions with other molecules. 1,3-Benzoxazol-2-ylmethanol may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its derivatives can be explored for various applications, including as fluorescent probes or in the synthesis of more complex organic compounds. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.

Formula: C₈H₇NO₂

InChI: InChI=1/C8H7NO2/c10-5-8-9-6-3-1-2-4-7(6)11-8/h1-4,10H,5H2

SMILES: c1ccc2c(c1)nc(CO)o2

Synonyms:

• 2-Benzoxazolemethanol
• 1,3-Benzoxazol-2-ylmethanol

Benzo[d]oxazol-2-ylmethanol

CAS: 77186-95-9

Formula: C₈H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 149.1467

Ref: IN-DA005P53

Benzo[d]oxazol-2-ylmethanol

CAS: 77186-95-9

Benzo[d]oxazol-2-ylmethanol

Purity: 96%

Molecular weight: 149.15g/mol

Ref: 54-OR902294

Benzo[d]oxazol-2-ylmethanol

CAS: 77186-95-9

Formula: C₈H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 149.149

Ref: 10-F077558