CAS 77189-05-0

2-(2-ethylhexyl)cyclohexanol

Description:

2-(2-Ethylhexyl)cyclohexanol, with the CAS number 77189-05-0, is an organic compound characterized by its cyclohexanol structure substituted with a 2-ethylhexyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate viscosity. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the cyclohexanol moiety imparts certain alcohol characteristics, making it a potential candidate for use as a solvent, plasticizer, or in the formulation of surfactants. Its chemical properties include the ability to participate in hydrogen bonding due to the hydroxyl (-OH) group, which can influence its reactivity and interactions with other substances. Additionally, 2-(2-ethylhexyl)cyclohexanol may exhibit low volatility and stability under standard conditions, making it suitable for various industrial applications. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.

Formula: C₁₄H₂₈O

InChI: InChI=1/C14H28O/c1-3-5-8-12(4-2)11-13-9-6-7-10-14(13)15/h12-15H,3-11H2,1-2H3

SMILES: CCCCC(CC)CC1CCCCC1O

Synonyms:

• Cyclohexanol, 2-(2-ethylhexyl)-