CymitQuimica logo

CAS 77196-89-5

:

N-Hydroxy-4-methyl-1,2,3-thiadiazole-5-carboxamide

Description:
N-Hydroxy-4-methyl-1,2,3-thiadiazole-5-carboxamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, a hydroxyl group, and a carboxamide functional group. This compound typically exhibits properties associated with both heterocyclic compounds and amides, such as potential solubility in polar solvents due to the presence of the hydroxyl and amide groups. The thiadiazole moiety may contribute to its biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may participate in various chemical reactions, including those involving nucleophilic attack or coordination with metal ions. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-Hydroxy-4-methyl-1,2,3-thiadiazole-5-carboxamide is a compound of interest in both synthetic and medicinal chemistry, with potential applications in drug development and agrochemicals.
Formula:C4H5N3O2S
InChI:InChI=1S/C4H5N3O2S/c1-2-3(4(8)6-9)10-7-5-2/h9H,1H3,(H,6,8)
InChI key:InChIKey=LCMJFJZBUAKZCX-UHFFFAOYSA-N
SMILES:C(NO)(=O)C1=C(C)N=NS1
Synonyms:
  • 1,2,3-Thiadiazole-5-carboxamide, N-hydroxy-4-methyl-
  • N-Hydroxy-4-methyl-1,2,3-thiadiazole-5-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.