CAS 77198-99-3
:N-(2-phenylethyl)benzenesulfonamide
Description:
N-(2-phenylethyl)benzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is attached to a phenyl group and an ethyl chain. This compound features a sulfonamide linkage (-SO2NH-) that contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the phenyl groups enhances its lipophilicity, which can influence its solubility and permeability in biological systems. Typically, sulfonamides exhibit antibacterial properties, and derivatives like this one may also show activity against various biological targets. The compound is likely to be a solid at room temperature, with a specific melting point and solubility profile that would depend on its molecular structure. Its chemical stability, reactivity, and potential applications in pharmaceuticals or as a reagent in organic synthesis can be further explored through experimental studies. Safety data sheets would provide necessary handling and toxicity information, as with many sulfonamide compounds, caution is advised due to potential allergic reactions in sensitive individuals.
Formula:C14H15NO2S
InChI:InChI=1/C14H15NO2S/c16-18(17,14-9-5-2-6-10-14)15-12-11-13-7-3-1-4-8-13/h1-10,15H,11-12H2
SMILES:c1ccc(cc1)CCNS(=O)(=O)c1ccccc1
Synonyms:- benzenesulfonamide, N-(2-phenylethyl)-
- N-Phenethylbenzenesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-(2-Phenylethyl)benzenesulfonamide
CAS:N-(2-Phenylethyl)benzenesulfonamide is a biodegradable and aerobic catalyst that is used in the production of nitrates. It can be recycled and has a high solubility, which allows for efficient extraction from wastewater effluents. The reactor system can be operated at an aerobic or anaerobic conditions. N-(2-Phenylethyl)benzenesulfonamide is soluble in water and can be hydrolyzed by acids or bases to release ammonia gas. The process can also be sustainable due to the use of renewable energy sources such as solar, wind, tidal, or biomass power.
Formula:C14H15NO2SPurity:Min. 95%Molecular weight:261.34 g/mol
