CAS 772-67-8

1-Fluoro-4-phenyl-2-butanone

Description:

1-Fluoro-4-phenyl-2-butanone, with the CAS number 772-67-8, is an organic compound characterized by the presence of a fluoro group and a phenyl group attached to a butanone backbone. This compound typically exhibits a polar nature due to the electronegative fluorine atom, which can influence its reactivity and solubility in various solvents. It is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the phenyl group contributes to its aromatic characteristics, potentially affecting its stability and interaction with other chemical species. Additionally, the compound may exhibit specific physical properties such as boiling and melting points, which are influenced by its molecular structure. Safety data sheets should be consulted for handling and storage guidelines, as the compound may pose health risks if not managed properly. Overall, 1-Fluoro-4-phenyl-2-butanone is a valuable compound in synthetic organic chemistry with diverse applications.

Formula: C₁₀H₁₁FO

InChI: InChI=1S/C10H11FO/c11-8-10(12)7-6-9-4-2-1-3-5-9/h1-5H,6-8H2

InChI key: InChIKey=UZHUCKRPDJKLDZ-UHFFFAOYSA-N

SMILES: C(CC(CF)=O)C1=CC=CC=C1

Synonyms:

• 2-Butanone 1-fluoro-4-phenyl-
• 2-Butanone, 1-fluoro-4-phenyl-
• 1-Fluoro-4-phenyl-2-butanone
• 1-Fluoro-4-phenylbutan-2-one
• 1-Fluoro-4-phenyl-butan-2-one