
CAS 772-96-3
:(T-4)-(N,N-Dimethylbenzenemethanamine)trifluoroboron
Description:
The chemical substance known as (T-4)-(N,N-Dimethylbenzenemethanamine)trifluoroboron, with the CAS number 772-96-3, is a complex organic compound that features a trifluoroboron moiety attached to a dimethylbenzenemethanamine structure. This compound typically exhibits characteristics associated with both amines and boron compounds, including potential basicity due to the amine group and unique reactivity due to the presence of the trifluoroboron group. It may be used in various applications, including as a reagent in organic synthesis or as a catalyst in certain chemical reactions. The trifluoroboron component can enhance the electrophilic properties of the molecule, making it useful in specific chemical transformations. Additionally, the presence of the dimethylbenzene moiety may impart hydrophobic characteristics, influencing solubility and interaction with other substances. Safety data should be consulted, as compounds containing boron and amine functionalities can pose health risks if not handled properly. Overall, this compound exemplifies the diverse chemistry of organoboron compounds and their utility in synthetic organic chemistry.
Formula:C9H13BF3N
InChI:InChI=1S/C9H13BF3N/c1-14(2,10(11,12)13)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3
InChI key:InChIKey=CAXSYZAKMYXTEZ-UHFFFAOYSA-N
SMILES:C([N]([B+3]([F-])([F-])[F-])(C)C)C1=CC=CC=C1
Synonyms:- Benzenemethanamine, N,N-dimethyl-, compd. with trifluoroborane (1:1)
- Boron, (N,N-dimethylbenzenemethanamine)trifluoro-, (T-4)-
- Benzylamine, N,N-dimethyl-, compd. with BF3
- Benzylamine, N,N-dimethyl-, compd. with boron fluoride (BF3) (1:1)
- Benzylamine, N,N-dimethyl-, compd. with BF3 (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boron, (N,N-dimethylbenzenemethanamine)trifluoro-, (T-4)-
CAS:Formula:C9H13BF3NMolecular weight:203.0124
