CAS 77208-18-5
:(1R,2S,3S,4R)-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol
Description:
(1R,2S,3S,4R)-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol, with the CAS number 77208-18-5, is a polycyclic aromatic compound characterized by its complex structure featuring multiple hydroxyl groups and a fused ring system. This compound is a derivative of chrysene, which is a four-ring polycyclic aromatic hydrocarbon. The specific stereochemistry indicated by the (1R,2S,3S,4R) configuration suggests that it has distinct spatial arrangements that can influence its chemical reactivity and biological activity. The presence of four hydroxyl (-OH) groups contributes to its solubility in polar solvents and may enhance its potential for hydrogen bonding. Such compounds are often studied for their potential applications in fields like medicinal chemistry and materials science, particularly due to their unique electronic properties and interactions with biological systems. Additionally, the stereochemistry may play a crucial role in determining the compound's pharmacological effects, making it a subject of interest in research related to drug development and environmental chemistry.
Formula:C18H16O4
InChI:InChI=1/C18H16O4/c19-15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16(20)18(22)17(15)21/h1-8,15-22H/t15-,16-,17+,18+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(1R,2S,3S,4R)-1,2,3,4-Tetrahydrochrysene-1,2,3,4-tetrol
CAS:Controlled ProductFormula:C18H16O4Color and Shape:NeatMolecular weight:296.317(1R,2S,3S,4R)-1,2,3,4-Tetrahydrochrysene-1,2,3,4-tetrol-d6
CAS:Controlled ProductFormula:C18D6H10O4Color and Shape:NeatMolecular weight:302.354
