CymitQuimica logo

CAS 77211-76-8

:

Phenylmethyl 4-hydroxy-4-[(phenylamino)methyl]-1-piperidinecarboxylate

Description:
Phenylmethyl 4-hydroxy-4-[(phenylamino)methyl]-1-piperidinecarboxylate, with the CAS number 77211-76-8, is a chemical compound that belongs to the class of piperidine derivatives. This substance typically exhibits characteristics such as a complex molecular structure, which includes a piperidine ring, hydroxyl group, and phenyl groups. It is often studied for its potential pharmacological properties, particularly in the context of medicinal chemistry. The presence of the hydroxyl group may contribute to its solubility in polar solvents, while the phenyl groups can enhance its lipophilicity, affecting its bioavailability and interaction with biological targets. Additionally, the compound may exhibit specific stereochemistry, influencing its biological activity. As with many organic compounds, its stability, reactivity, and potential applications can vary based on environmental conditions and the presence of other chemical entities. Further research is typically required to fully elucidate its properties and potential uses in various fields, including pharmaceuticals and materials science.
Formula:C20H24N2O3
InChI:InChI=1S/C20H24N2O3/c23-19(25-15-17-7-3-1-4-8-17)22-13-11-20(24,12-14-22)16-21-18-9-5-2-6-10-18/h1-10,21,24H,11-16H2
InChI key:InChIKey=JFFNFUMDVAEEDU-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)C2(O)CCN(C(OCC3=CC=CC=C3)=O)CC2
Synonyms:
  • 1-Piperidinecarboxylic acid, 4-hydroxy-4-[(phenylamino)methyl]-, phenylmethyl ester
  • Phenylmethyl 4-hydroxy-4-[(phenylamino)methyl]-1-piperidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.