CAS 77222-65-2

3,3'-[7-ethenyl-12-(1-hydroxyethyl)-3,8,13,17-tetramethylporphyrin-2,18-diyl]dipropanoic acid

Description:

3,3'-[7-ethenyl-12-(1-hydroxyethyl)-3,8,13,17-tetramethylporphyrin-2,18-diyl]dipropanoic acid, with CAS number 77222-65-2, is a synthetic porphyrin derivative characterized by its complex structure, which includes a porphyrin core modified with various functional groups. Porphyrins are known for their ability to coordinate with metal ions, making them significant in biological systems, particularly in hemoglobin and chlorophyll. This specific compound features a vinyl group and a hydroxyethyl substituent, which can influence its solubility and reactivity. The presence of dipropanoic acid moieties suggests potential for forming salts or participating in esterification reactions. Its unique structure may impart specific optical properties, making it useful in applications such as photodynamic therapy, sensors, or as a dye. Additionally, the tetramethyl substitution can enhance its stability and solubility in organic solvents. Overall, this compound exemplifies the diverse chemistry of porphyrins and their derivatives, with potential implications in medicinal chemistry and materials science.

Formula: C₃₄H₃₆N₄O₅

InChI: InChI=1/C34H36N4O5/c1-7-21-16(2)26-14-31-34(20(6)39)19(5)27(38-31)12-24-17(3)22(8-10-32(40)41)29(36-24)15-30-23(9-11-33(42)43)18(4)25(37-30)13-28(21)35-26/h7,12-15,20,35,38-39H,1,8-11H2,2-6H3,(H,40,41)(H,42,43)/b24-12-,25-13-,26-14-,27-12-,28-13-,29-15-,30-15-,31-14-

SMILES: C=Cc1c(C)c2=Cc3c(c(C)c(C=C4C(=C(CCC(=O)O)C(=N4)C=C4C(=C(C)C(=N4)C=c1[nH]2)CCC(=O)O)C)[nH]3)C(C)O

Deuteroporphyrin IX 2,4 (4,2) hydroxyethyl vinyl

CAS: 77222-65-2

Purity: >95%

Molecular weight: 580.68

Ref: FT-HVD580-9