CAS 77223-21-3

7-chloro-2,4-dimethyl-1,8-naphthyridine

Description:

7-Chloro-2,4-dimethyl-1,8-naphthyridine is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. The presence of chlorine and methyl groups at specific positions on the naphthyridine ring contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to its aromatic nature, which can influence its solubility in organic solvents. It may also display biological activity, making it of interest in medicinal chemistry and drug development. The chlorine atom can enhance the compound's reactivity and potential interactions with biological targets. Additionally, the methyl groups can affect the steric and electronic properties, influencing the compound's overall stability and reactivity. As with many heterocycles, 7-chloro-2,4-dimethyl-1,8-naphthyridine may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile building block in organic synthesis. Its specific applications and behavior would depend on the context of its use in research or industry.

Formula: C₁₀H₉ClN₂

InChI: InChI=1/C10H9ClN2/c1-6-5-7(2)12-10-8(6)3-4-9(11)13-10/h3-5H,1-2H3

SMILES: Cc1cc(C)nc2c1ccc(Cl)n2

Synonyms:

• 1,8-Naphthyridine, 7-Chloro-2,4-Dimethyl-
• 7-Chloro-2,4-dimethyl-1,8-naphthyridine

1,8-Naphthyridine,7-chloro-2,4-dimethyl-

CAS: 77223-21-3

Formula: C₁₀H₉ClN₂

Purity: 97%

Molecular weight: 192.6449

Ref: IN-DA008NK1

7-Chloro-2,4-dimethyl-[1,8]naphthyridine

CAS: 77223-21-3

7-Chloro-2,4-dimethyl-[1,8]naphthyridine

Purity: 97%

Molecular weight: 192.64486g/mol

Ref: 54-OR75421

7-Chloro-2,4-dimethyl-[1,8]naphthyridine

CAS: 77223-21-3

Formula: C₁₀H₉ClN₂

Purity: 97%

Molecular weight: 192.65

Ref: 10-F494907