CAS 77224-08-9

2-Amino-4-O-(2-amino-2-deoxy-β-D-glucopyranosyl)-2-deoxy-β-D-glucopyranose

Description:

2-Amino-4-O-(2-amino-2-deoxy-β-D-glucopyranosyl)-2-deoxy-β-D-glucopyranose, also known by its CAS number 77224-08-9, is a complex carbohydrate derivative that features both amino and deoxy functionalities. This compound is characterized by its dual sugar structure, consisting of two β-D-glucopyranose units linked through a glycosidic bond, with an amino group at the 2-position of the sugar moieties. The presence of the amino group enhances its solubility in water and may influence its biological activity, making it of interest in biochemical and pharmaceutical research. This compound is typically white to off-white in appearance and is soluble in polar solvents due to its hydroxyl and amino groups. Its structural complexity allows it to participate in various biochemical interactions, potentially serving as a substrate or inhibitor in enzymatic reactions. Additionally, it may have implications in glycosylation processes and could be studied for its role in cellular signaling or as a potential therapeutic agent.

Formula: C₁₂H₂₄N₂O₉

InChI: InChI=1S/C12H24N2O9/c13-5-9(19)10(4(2-16)21-11(5)20)23-12-6(14)8(18)7(17)3(1-15)22-12/h3-12,15-20H,1-2,13-14H2/t3-,4-,5-,6-,7-,8-,9-,10-,11-,12+/m1/s1

InChI key: InChIKey=QLTSDROPCWIKKY-PMCTYKHCSA-N

SMILES: O([C@@H]1[C@@H](CO)O[C@@H](O)[C@H](N)[C@H]1O)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N

Synonyms:

• 2-Amino-4-O-(2-amino-2-deoxy-β-D-glucopyranosyl)-2-deoxy-β-D-glucopyranose
• β-D-Glucopyranose, 2-amino-4-O-(2-amino-2-deoxy-β-D-glucopyranosyl)-2-deoxy-

Glucose Impurity 13 (Chitobiose)

CAS: 77224-08-9

Formula: C₁₂H₂₄N₂O₉

Molecular weight: 340.33

Ref: 4Z-G-067061