CAS 77227-69-1
:Halosafen
Description:
Halosafen, identified by the CAS number 77227-69-1, is a chemical compound that belongs to the class of herbicides. It is primarily used in agricultural applications for the control of various weeds in crops. Halosafen functions by inhibiting specific biochemical pathways in plants, leading to their growth suppression or death. The compound is characterized by its selective action, which allows it to target unwanted vegetation while minimizing harm to desirable crops. Halosafen is typically applied in pre-emergence or post-emergence stages, depending on the target species and crop type. Its chemical structure includes halogen substituents, which contribute to its herbicidal properties. As with many agrochemicals, proper handling and application are crucial to minimize environmental impact and ensure safety. Users must adhere to regulatory guidelines and safety data sheets to mitigate risks associated with exposure. Overall, Halosafen is an important tool in modern agriculture, aiding in effective weed management strategies.
Formula:C16H11ClF4N2O6S
InChI:InChI=1S/C16H11ClF4N2O6S/c1-2-30(27,28)22-15(24)10-7-9(3-4-13(10)23(25)26)29-14-11(17)5-8(6-12(14)18)16(19,20)21/h3-7H,2H2,1H3,(H,22,24)
InChI key:InChIKey=QQOGZMUZAZWLJH-UHFFFAOYSA-N
SMILES:C(NS(CC)(=O)=O)(=O)C1=C(N(=O)=O)C=CC(OC2=C(Cl)C=C(C(F)(F)F)C=C2F)=C1
Synonyms:- 5-[2-Chlor-6-fluor-4-(trifluormethyl)phenoxy]-N-(ethylsulfonyl)-2-nitrobenzamid
- 77227-69-1
- Benzamide, 5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-N-(ethylsulfonyl)-2-nitro-
- Halosafen
- 5-[2-Chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-N-(ethylsulfonyl)-2-nitrobenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.