CAS 77228-67-2

(4-bromo-2-chlorophenoxy)acetate

Description:

(4-bromo-2-chlorophenoxy)acetate, with the CAS number 77228-67-2, is an organic compound that features a phenoxy group substituted with both bromine and chlorine atoms, as well as an acetate functional group. This compound is characterized by its aromatic structure, which contributes to its chemical stability and potential reactivity. The presence of halogen substituents (bromine and chlorine) can influence its physical properties, such as solubility and boiling point, as well as its reactivity in various chemical reactions, including nucleophilic substitutions. Typically, compounds like this may exhibit biological activity, making them of interest in fields such as agrochemicals or pharmaceuticals. Its synthesis often involves the reaction of phenolic compounds with acetic anhydride or acetyl chloride, followed by halogenation. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, (4-bromo-2-chlorophenoxy)acetate is a notable compound in organic chemistry with potential applications in various scientific fields.

Formula: C₈H₅BrClO₃

InChI: InChI=1/C8H6BrClO3/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3H,4H2,(H,11,12)/p-1

SMILES: c1cc(c(cc1Br)Cl)OCC(=O)[O-]

2-(4-Bromo-2-chlorophenoxy)acetic acid

CAS: 77228-67-2

Formula: C₈H₆BrClO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 265.4884

Ref: IN-DA005ON0

2-(4-Bromo-2-Chlorophenoxy)Acetic Acid

CAS: 77228-67-2

2-(4-Bromo-2-Chlorophenoxy)Acetic Acid

Purity: 99%

Molecular weight: 265.49g/mol

Ref: 54-OR1030476

(4-bromo-2-chlorophenoxy)acetic acid

CAS: 77228-67-2

Formula: C₈H₆BrClO₃

Purity: 98%

Molecular weight: 265.49

Ref: 10-F307493

(4-Bromo-2-chlorophenoxy)acetic Acid

Controlled Product

CAS: 77228-67-2

Applications (4-Bromo-2-chlorophenoxy)acetic acid

Formula: C₈H₆BrClO₃

Color and Shape: Neat

Molecular weight: 265.49

Ref: TR-B684173