CAS 772311-98-5

4-[(2-methyl-1H-imidazol-1-yl)methyl]aniline

Description:

4-[(2-methyl-1H-imidazol-1-yl)methyl]aniline, with the CAS number 772311-98-5, is an organic compound characterized by its imidazole and aniline functional groups. This substance typically appears as a solid or crystalline material and is soluble in polar solvents due to the presence of the imidazole ring, which can engage in hydrogen bonding. The compound features a methyl group attached to the imidazole, enhancing its lipophilicity and potentially influencing its biological activity. The aniline portion of the molecule contributes to its reactivity, particularly in electrophilic aromatic substitution reactions. This compound may exhibit various properties, including potential antimicrobial or pharmacological activities, making it of interest in medicinal chemistry. Its synthesis often involves the reaction of an appropriate aniline derivative with a suitable imidazole precursor. Safety data should be consulted for handling, as compounds with amine functionalities can be hazardous. Overall, 4-[(2-methyl-1H-imidazol-1-yl)methyl]aniline represents a versatile building block in organic synthesis and drug development.

Formula: C₁₁H₁₃N₃

InChI: InChI=1/C11H13N3/c1-9-13-6-7-14(9)8-10-2-4-11(12)5-3-10/h2-7H,8,12H2,1H3

SMILES: Cc1nccn1Cc1ccc(cc1)N

Synonyms:

• benzenamine, 4-[(2-methyl-1H-imidazol-1-yl)methyl]-
• 4-[(2-Methyl-1H-imidazol-1-yl)methyl]aniline