CAS 77234-66-3

1-{4-[(2R)-butan-2-yl]phenyl}-2-chloroethanone

Description:

1-{4-[(2R)-butan-2-yl]phenyl}-2-chloroethanone, with the CAS number 77234-66-3, is an organic compound characterized by its structure, which includes a phenyl group substituted with a butan-2-yl group and a chloroethanone moiety. This compound typically exhibits properties common to ketones, such as being a polar molecule due to the presence of the carbonyl group, which can engage in hydrogen bonding. The chloro substituent introduces additional reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its stereochemistry, indicated by the (2R) designation, suggests that it has specific spatial arrangements that can influence its biological activity and interactions. The presence of the butan-2-yl group may also contribute to its hydrophobic characteristics, affecting solubility in different solvents. Overall, this compound may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules.

Formula: C₁₂H₁₅ClO

InChI: InChI=1/C12H15ClO/c1-3-9(2)10-4-6-11(7-5-10)12(14)8-13/h4-7,9H,3,8H2,1-2H3/t9-/m1/s1

SMILES: CC[C@@H](C)c1ccc(cc1)C(=O)CCl

1-[4-(Butan-2-yl)phenyl]-2-chloroethan-1-one

CAS: 77234-66-3

Versatile small molecule scaffold

Formula: C₁₂H₁₅ClO

Purity: Min. 95%

Molecular weight: 210.7 g/mol

Ref: 3D-CDA23466